BindingDB logo
myBDB logout

12 SMILES Strings for Beta-amyloid protein 40

Compound NameSMILES String
BDBM50129271 Fc1ccc(F)c2c1OC[C@H]1C3(CCC[C@@]21S(=O)(=O)c1ccc(Cl)cc1)CCS(=O)(=O)CC3 |r|
BDBM50129278 Fc1ccc(F)c2c1OC[C@H]1C3(CCC[C@@]21S(=O)(=O)c1ccc(Cl)cc1)CCSCC3 |r|
BDBM50129272 Fc1ccc(F)c2c1OCC1[C@@]3(CCN(C3)S(=O)(=O)C(F)(F)F)CCCC21S(=O)(=O)c1ccc(Cl)cc1 |r|
BDBM50129269 Fc1ccc(F)c2c1OC[C@H]1[C@]3(CCOC3)CCC[C@@]21S(=O)(=O)c1ccc(Cl)cc1 |r|
BDBM250503 C[P@@]1(=O)OC[C@]2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(cc2)C(F)(F)F)CO1 |r|
BDBM250504 C[P@]1(=O)OC[C@]2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(cc2)C(F)(F)F)CO1 |r|
BDBM250505 CP1(=O)OCC[C@]2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(Cl)cc2)CO1 |r,w:1.0|
BDBM50129277 Fc1ccc(F)c2c1OC[C@H]1C3(COC3)CCC[C@@]21S(=O)(=O)c1ccc(Cl)cc1 |r|
BDBM250501 C[P@]1(=O)OC[C@]2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(Cl)cc2)CO1 |r|
BDBM250502 C[P@@]1(=O)OC[C@]2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(Cl)cc2)CO1 |r|
BDBM50129276 CC1(C)OCC2(CCC[C@@]3([C@H]2COc2c(F)ccc(F)c32)S(=O)(=O)c2ccc(Cl)cc2)CO1
BDBM50129270 Fc1ccc(F)c2c1OC[C@H]1[C@@]3(CCOC3=O)CCC[C@@]21S(=O)(=O)c1ccc(Cl)cc1 |r|