BindingDB logo
myBDB logout

6 SMILES Strings for Beta-amyloid protein 42

Compound NameSMILES String
BDBM155391 COc1ccccc1NC(=O)C(=O)N\N=C(\CC(=O)c1cccs1)C(F)(F)F
BDBM155392 CCOC(=O)c1c(NC(=O)C(=O)N\N=C\c2cccc(OC)c2O)sc2CC(C)CCc12
BDBM155393 CCOC(=O)c1c(NC(=O)C(=O)N\N=C\c2c(O)ccc3ccccc23)sc2CC(C)CCc12
BDBM155394 CCOC(=O)c1c(NC(=O)C(=O)N\N=C\c2ccccc2O)sc2CC(C)CCc12
BDBM155395 COc1ccccc1NC(=O)C(=O)N1N=C(CC(C)C)CC1(O)C(F)(F)F |t:15|
BDBM155396 Oc1ccccc1C(=O)N\N=C\c1ccc2ccccc2c1O