BindingDB logo
myBDB logout

25 SMILES Strings for Beta-catenin

Compound NameSMILES String
BDBM32102 Cn1ncnc2c1nc(=O)n(C)c2=O
BDBM50392084 NC(=O)c1ccccc1Oc1ccccc1
BDBM50094484 COc1c(C[C@H](C)O)c2c3c(C[C@H](C)O)c(OC)c(=O)c4c(O)cc5OCOc6cc(O)c(c2c6c5c34)c1=O |r|
BDBM50094602 Cc1cc(\C=C2/SC(=O)N(C2=O)c2ccccc2)c(C)n1-c1cccnc1
BDBM213748 COc1cc(O)c2c3c1c1c(OC)cc(O)c4c1c(c(C[C@@H](C)OC(=O)c1ccccc1)c(OC)c4=O)c3c(C[C@@H](C)OC(=O)Oc1ccc(O)cc1)c(OC)c2=O |r|
BDBM213749 COc1ccc(\C=C2/SC(=S)N(CCCC(O)=O)C2=O)cc1OC
BDBM213753 On1nnc2cc(COCc3nn[nH]n3)ccc12
BDBM213754 On1nnc2cc(CC[N]3=NNN=C3)ccc12 |c:12,t:9|
BDBM213755 On1nnc2cc(CCc3noc(=O)[nH]3)ccc12
BDBM213756 On1nnc2cc(CCc3noc(=S)[nH]3)ccc12
BDBM213757 On1nnc2cc(OCc3nn[nH]n3)ccc12
BDBM213761 On1nnc2cc(CCc3nn[nH]n3)ccc12
BDBM213762 On1ncc2cc(CCc3noc(=O)[nH]3)ccc12
BDBM213763 On1ncc2cc(CCc3noc(=S)[nH]3)ccc12
BDBM213764 On1ncc2cc(COC[N]3=NNN=C3)ccc12 |c:13,t:10|
BDBM213765 C(Cc1ccc2[nH]ncc2c1)c1nn[nH]n1
BDBM213766 On1ncc2cc(NCc3nn[nH]n3)ccc12
BDBM213767 Cc1noc(C)c1C(=O)N(Cc1nn[nH]n1)c1ccc2n(O)ncc2c1
BDBM213768 On1ncc2cc(ccc12)N(Cc1nn[nH]n1)C(=O)c1cc(F)cc(Br)c1
BDBM213769 On1ncc2cc(ccc12)N(Cc1nn[nH]n1)C(=O)c1cccc(Cl)c1
BDBM213770 On1ncc2cc(ccc12)N(Cc1nn[nH]n1)C(=O)c1cccnc1
BDBM50094606 CCc1ccc(cc1)-c1nc(CSCC(=O)NCCc2ccccc2)c(C)o1
BDBM213750 On1nnc2cc(Cc3nn[nH]n3)ccc12
BDBM213751 On1nnc2cc(Cc3noc(=O)[nH]3)ccc12
BDBM213752 On1nnc2cc(Cc3noc(=S)[nH]3)ccc12