BindingDB logo
myBDB logout

4 SMILES Strings for Beta-catenin/APC-R3

Compound NameSMILES String
BDBM32102 Cn1ncnc2c1nc(=O)n(C)c2=O
BDBM50094484 COc1c(C[C@H](C)O)c2c3c(C[C@H](C)O)c(OC)c(=O)c4c(O)cc5OCOc6cc(O)c(c2c6c5c34)c1=O |r|
BDBM213748 COc1cc(O)c2c3c1c1c(OC)cc(O)c4c1c(c(C[C@@H](C)OC(=O)c1ccccc1)c(OC)c4=O)c3c(C[C@@H](C)OC(=O)Oc1ccc(O)cc1)c(OC)c2=O |r|
BDBM213761 On1nnc2cc(CCc3nn[nH]n3)ccc12