BindingDB logo
myBDB logout

10 SMILES Strings for Beta-catenin-interacting protein 1

Compound NameSMILES String
BDBM270440 CN(C)Cc1cc(F)cc(c1)-c1cncc2[nH]c(nc12)-c1n[nH]c2ncc(cc12)-c1cccnc1
BDBM270451 CN(C)Cc1cncc(c1)-c1cnc2[nH]nc(-c3nc4c(cncc4[nH]3)-c3cccc(F)c3)c2c1
BDBM269257 Nc1cncc(c1)-c1cnc2[nH]nc(-c3nc4c(cncc4[nH]3)-c3cccc(F)c3)c2c1
BDBM269259 CN(C)c1cncc(c1)-c1cnc2[nH]nc(-c3nc4c(cncc4[nH]3)-c3cccc(F)c3)c2c1
BDBM269261 CC(C)Nc1cncc(c1)-c1cnc2[nH]nc(-c3nc4c(cncc4[nH]3)-c3cccc(F)c3)c2c1
BDBM269262 CN1CCN(Cc2cc(F)cc(c2)-c2cncc3[nH]c(nc23)-c2n[nH]c3ncc(cc23)-c2cccnc2)CC1
BDBM269263 CN1CCN(CC1)c1cc(F)cc(c1)-c1cncc2[nH]c(nc12)-c1n[nH]c2ncc(cc12)-c1cccnc1
BDBM270306 CN(C)CCNc1cc(F)cc(c1)-c1cncc2[nH]c(nc12)-c1n[nH]c2ncc(cc12)-c1cccnc1
BDBM275495 CN(C)Cc1cncc(c1)-c1cnc2[nH]nc(-c3nc4c(cncc4[nH]3)-c3cccs3)c2c1
BDBM275766 Oc1ccc(CC2N3C(CN(Cc4cccc5ccccc45)C2=O)N(CCC3=O)C(=O)NCc2ccccc2)cc1