BindingDB logo
myBDB logout

5 SMILES Strings for Beta-galactosidase/Glucosylceramidase

Compound NameSMILES String
BDBM50104295 CC(NCC1NCC(O)C1O)C(O)(c1ccccc1)c1ccccc1
BDBM50403936 CCOC(=O)c1cc(oc1C)[C@H]1NC[C@@H](O)[C@H]1O |r|
BDBM50403937 CCN(CC)C(=O)c1cc(oc1C)[C@H]1NC[C@@H](O)[C@H]1O |r|
BDBM50220499 CCOC(=O)c1cc(oc1C)[C@@H]1NC[C@@H](O)[C@H]1O |r|
BDBM50220500 CC(C)NC(=O)c1cc(oc1C)[C@H]1NC[C@@H](O)[C@H]1O |r|