BindingDB logo
myBDB logout

11 SMILES Strings for Beta-glucosidase cytosolic

Compound NameSMILES String
BDBM18351 OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
BDBM50118923 CCCCCCCCNC1CC(C)C(O)C(O)C1O
BDBM50153474 CCCCCCCCNC1CC(=C)C(O)C(O)C1O
BDBM50153475 CCCCCCCCNC1CC(CO)C(O)C(O)C1O
BDBM50153478 CC(=O)NC1CC(CO)C(O)C(O)C1O
BDBM50153476 CO[C@@H]1CC2COC([C@H]2NC2CC(CO)C(O)C(O)C2O)C1O |TLB:1:2:8:6.5,9:8:21.2.3:6.5,THB:22:21:8:6.5|
BDBM50163441 OC[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O
BDBM50163447 OC[C@@H]1NC[C@@H](O)[C@H](O)[C@H]1O
BDBM50234564 OC[C@H]1N[C@@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM50367332 N[C@H]1C[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
BDBM50383315 CCCCCCCCSCC[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O |r|