BindingDB logo
myBDB logout

8 SMILES Strings for Beta-glucuronidase

Compound NameSMILES String
BDBM7458 Oc1ccc(cc1)-c1cc(=O)c2c(O)cc(O)cc2o1
BDBM79181 CN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1
BDBM50077323 Oc1ccc(cc1)-c1cc(=O)c2ccc(O)cc2o1
BDBM50142190 C[C@](O)(CO)c1cc2c3O[C@@H]4[C@@H](COc5cc(O)ccc45)c3ccc2o1
BDBM50142191 COc1cc(O)ccc1-c1coc2cc(O)cc(O)c2c1=O
BDBM50142192 Oc1ccc(c(O)c1)-c1coc2cc(O)cc(O)c2c1=O
BDBM50142193 Oc1ccc(c(O)c1)-c1coc2cc(O)ccc2c1=O
BDBM50366927 OC[C@H]1OC(Oc2cc(O)c3c(c2)oc(-c2ccc(O)cc2)c(O)c3=O)[C@H](O)[C@@H](O)[C@@H]1O |r|