BindingDB logo
myBDB logout

6 SMILES Strings for Beta-glucuronidase (CpGUS)

Compound NameSMILES String
BDBM163636 CCOc1ccc(NC(=S)N(CCO)Cc2cc3cc(C)cc(C)c3[nH]c2=O)cc1
BDBM163637 COc1cccc(NC(=S)N(CCO)Cc2cc3cc(C)c(C)cc3[nH]c2=O)c1
BDBM163638 Cc1ccc2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccccc3F)cc2c1
BDBM163639 CCc1ccc2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccccc3C(=O)OC)cc2c1
BDBM163640 CC1CCc2c(C1)sc1nc(C)nc(N3CCNCC3)c21
BDBM163641 Fc1cccc(c1)-c1cc2nc3CCCCc3c(N3CCNCC3)n2n1