BindingDB logo
myBDB logout

16 SMILES Strings for Beta-glucuronidase (EcGUS)

Compound NameSMILES String
BDBM152586 OC(C1OC(=O)C(O)C1O)C(O)=O
BDBM91713 C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CCC2=O |t:8|
BDBM50223368 C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@]34C)[C@@H]1CCC2=O |r,t:7|
BDBM163636 CCOc1ccc(NC(=S)N(CCO)Cc2cc3cc(C)cc(C)c3[nH]c2=O)cc1
BDBM163637 COc1cccc(NC(=S)N(CCO)Cc2cc3cc(C)c(C)cc3[nH]c2=O)c1
BDBM163638 Cc1ccc2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccccc3F)cc2c1
BDBM163639 CCc1ccc2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccccc3C(=O)OC)cc2c1
BDBM163640 CC1CCc2c(C1)sc1nc(C)nc(N3CCNCC3)c21
BDBM163641 Fc1cccc(c1)-c1cc2nc3CCCCc3c(N3CCNCC3)n2n1
BDBM163642 COC(=O)c1c(N)sc(C(=O)Nc2ccc(C)c(Cl)c2)c1C
BDBM163643 COC1CCC(OC)C(C1)NC(=O)CN1CCN(Cc2ccc3OCOc3c2)CC1
BDBM163644 Cc1cc(C)c2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccc(O)cc3)cc2c1
BDBM163645 Cc1cc(C)c2[nH]c(=O)c(CN(CCO)C(=S)Nc3ccc(cc3)N3CCOCC3)cc2c1
BDBM236512 C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)CC[C@]34C)[C@@H]1CCC2=O |r|
BDBM236513 C[C@]12CC[C@H]3[C@@H](CC(=O)C4=C[C@@H](O)CC[C@]34C)[C@@H]1CCC2=O |r,t:9|
BDBM236514 C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)[C@@H](O)CC1=C[C@@H](O)CC[C@]31C |r,t:16|