BindingDB logo
myBDB logout

5 SMILES Strings for Beta-hexosaminidase

Compound NameSMILES String
BDBM50335524 CCC(CC)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1=NOC(=O)Nc1ccccc1 |w:18.19|
BDBM50386412 CC(=O)N[C@H]1CN[C@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM50386413 C[C@@H](O[C@@H]1[C@H](CN[C@H](CO)[C@H]1O)NC(C)=O)C(O)=O |r|
BDBM50386414 C[C@H](NC(=O)[C@@H](C)O[C@@H]1[C@H](CN[C@H](CO)[C@H]1O)NC(C)=O)C(O)=O |r|
BDBM50386415 C[C@H](NC(=O)[C@@H](C)O[C@@H]1[C@H](CN[C@H](CO)[C@H]1O)NC(C)=O)C(=O)N[C@H](CCC(O)=O)C(O)=O |r|