BindingDB logo
myBDB logout

30 SMILES Strings for Beta-hexosaminidase subunit alpha (HexA)

Compound NameSMILES String
BDBM18512 CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM18775 Cc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM18779 CCc1nc(N)nc(N)c1-c1ccc(C)cc1
BDBM18780 CCc1nc(N)nc(N)c1-c1ccc(OC)cc1
BDBM18788 CCc1nc(N)nc(N)c1-c1ccccc1
BDBM50190644 [H][C@]12CS\C(=N/CCCCCCCC)N1C[C@H](NC(C)=O)[C@H](O)[C@@H]2O |r|
BDBM50190645 [H][C@]12CS\C(=N/c3ccccc3)N1C[C@H](NC(C)=O)[C@H](O)[C@@H]2O |r|
BDBM40765 CN1[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@H]1OS([O-])(=O)=O |r|
BDBM40767 CC1=NC2C(OC(OS([O-])(=O)=O)C(O)C2O)S1 |t:1|
BDBM68267 O=C1N(CC2CCCO2)C(=O)c2cccc3cccc1c23
BDBM68268 O=C1N(CCCc2ccccn2)C(=O)c2cccc3cccc1c23
BDBM68271 CCCNCCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM68272 CCCNCCCNCCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM68269 CC(O)CCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM68270 OCCCN1C(=O)c2cccc3cccc(C1=O)c23
BDBM50106194 O=C1NC(=O)c2cccc3cccc1c23
BDBM50394492 OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)c2nc(CCc3ccc(cc3)-c3ccccc3)cn12 |r|
BDBM50089672 CCc1nc(N)[nH]c(=O)c1-c1ccc(Cl)cc1
BDBM50089673 CCc1nc(N)ncc1-c1ccc(Cl)cc1
BDBM50089674 CCc1nc(N)ncc1-c1ccc(cc1)C(F)(F)F
BDBM50089675 CCc1ncncc1-c1ccc(cc1)C(F)(F)F
BDBM50089676 CCCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM50089677 CC(C)c1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM50089678 CCCCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM50089679 NCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM50089680 CCc1nc(N)nc(N)c1-c1ccc(cc1)C(F)(F)F
BDBM50089681 CCc1nc(N)nc(N)c1-c1cccc(C)c1
BDBM50089682 CCc1nc(N)nc(N)c1-c1ccccc1C |(-3.74,-.92,;-2.67,-1.54,;-1.33,-.77,;-1.33,.77,;,1.54,;,2.77,;1.33,.77,;1.33,-.77,;2.4,-1.39,;,-1.54,;,-3.08,;1.33,-3.85,;1.34,-5.39,;0,-6.16,;-1.33,-5.39,;-1.33,-3.85,;-2.4,-3.24,)|
BDBM50089683 CCc1nc(N)nc(N)c1-c1cc(C)cc(C)c1
BDBM50190643 CCCCCCCCNC(=S)N1C[C@H](NC(C)=O)[C@H](O)[C@H](O)[C@H]1CO |r|