BindingDB logo
myBDB logout

18 SMILES Strings for Beta-hexosaminidase subunit beta (Hex B)

Compound NameSMILES String
BDBM18512 CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM18788 CCc1nc(N)nc(N)c1-c1ccccc1
BDBM36546 CC(=O)NC1CN(CCCCCCCN)C(CO)C(O)C1O
BDBM36547 COc1ccc(CNCCCCCCCN2CC(NC(C)=O)C(O)C(O)C2CO)cc1
BDBM36548 COc1ccc(CN(CCCCCCCN2CC(NC(C)=O)C(O)C(O)C2CO)Cc2ccc(OC)cc2)cc1
BDBM36549 CC(=O)NC1CN(CCCCCCCNC(=O)CCCCC2SCC3NC(=O)NC23)C(CO)C(O)C1O
BDBM36550 CC(=O)NC1CN(CCCCCCCN=[N]#N)C(CO)C(O)C1O
BDBM40759 CC(=O)N[C@@H]1N[C@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM40760 CN1[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1NC(C)=O |r|
BDBM40761 CC(=O)N[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O |r|
BDBM40762 CN1[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |r|
BDBM40763 CN1CC(NC(C)=O)C(O)C(O)C1CO
BDBM40765 CN1[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@H]1OS([O-])(=O)=O |r|
BDBM40766 CC1NC2C(OC(CO)C(O)C2=O)S1
BDBM40767 CC1=NC2C(OC(OS([O-])(=O)=O)C(O)C2O)S1 |t:1|
BDBM50182804 CC(=O)N[C@H]1CN[C@H](CO)[C@@H](O)[C@@H]1O
BDBM50327038 CC1=N[C@H]2[C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)S1 |r,t:1|
BDBM50377445 CC1=N[C@H]2[C@H](O[C@H](CO)[C@H](O)[C@@H]2O)S1 |t:1|