BindingDB logo
myBDB logout

10 SMILES Strings for Beta-ketoacyl-ACP-synthase III

Compound NameSMILES String
BDBM50245877 Oc1cc(c(O)c2ccccc12)S(=O)(=O)c1ccccc1
BDBM50245878 CC(=O)Nc1ccc(cc1)S(=O)(=O)c1cc(O)c2ccccc2c1O
BDBM50245879 Oc1cc(c(O)c2ccccc12)S(=O)(=O)c1ccc(Cl)cc1
BDBM50245880 CCCc1ccc(cc1)S(=O)(=O)c1cc(O)c2ccccc2c1O
BDBM50245923 Oc1cc(c(O)c2ccccc12)S(=O)(=O)c1ccc2ccccc2c1
BDBM50245924 Cc1ccc(cc1)S(=O)(=O)c1cc(O)c2cc3ccccc3cc2c1O
BDBM50245928 Cc1ccc(cc1)S(=O)(=O)C1=CC(=O)c2ccccc2C1=O |t:11|
BDBM50245828 Cc1ccc(cc1)S(=O)(=O)c1cc(O)c2ccccc2c1O
BDBM50245829 CS(=O)(=O)c1cc(O)c2ccccc2c1O
BDBM50245830 OC(=O)CCS(=O)(=O)c1cc(O)c2ccccc2c1O