BindingDB logo
myBDB logout

14 SMILES Strings for Beta-lactamase (CTX-M)

Compound NameSMILES String
BDBM36442 O=C1N(CCc2nn[n-]n2)C(=O)c2ccccc12
BDBM36443 Nc1sc2CCCCc2c1-c1nn[n-]n1
BDBM36444 [O-]S(=O)(=O)C1=CC(=O)C(=O)c2ccccc12 |t:4|
BDBM36445 C(Oc1cccc(c1)-c1nn[n-]n1)c1ccccc1
BDBM36446 [O-]S(=O)(=O)[C@H]1CC(=O)C(=O)c2ccccc12
BDBM36447 O=c1n(Cc2nn[n-]n2)cnc2sc3CCCCc3c12
BDBM36448 Fc1cccc(c1)C(=O)Nc1cccc(c1)-c1nn[n-]n1
BDBM36449 Cn1cc(C(=O)Nc2cccc(c2)-c2nn[n-]n2)c2ccccc12
BDBM36450 O=C(Nc1cccc(c1)-c1nn[n-]n1)C(Sc1ccccc1)c1ccccc1
BDBM36437 CCc1c(C)[nH]n(-c2nn[n-]n2)c1=O
BDBM36438 O=C1CCCC(Nc2nn[n-]n2)=C1 |c:12|
BDBM36439 [O-]C(=O)[C@H]1C[C@H]1C(=O)Nc1cc(F)ccc1F
BDBM36440 C[C@H](N1C(=O)C2C3CCC(C3)C2C1=O)C([O-])=O
BDBM36441 [O-]C(=O)CN1C(=O)O[C@H](C1=O)c1ccccc1