BindingDB logo
myBDB logout

12 SMILES Strings for Beta-lactamase 1

Compound NameSMILES String
BDBM50021954 CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |r|
BDBM50285119 C[C@@]1(CCl)S[C@@H]2[C@@H](Br)C(=O)N2[C@H]1C(O)=O
BDBM50285120 C[C@]1(CCl)[C@@H](N2[C@@H]([C@@H](F)C2=O)S1(=O)=O)C(O)=O
BDBM50285121 CC1(C)[C@@H](N2[C@@H]([C@@H](Cl)C2=O)S1(=O)=O)C(O)=O
BDBM50285122 C[C@@]1(CSc2nc3ccccc3s2)S[C@@H]2[C@@H](F)C(=O)N2[C@H]1C(O)=O
BDBM50285123 C[C@@]1(CSc2nc3ccccc3s2)S[C@@H]2[C@@H](Br)C(=O)N2[C@H]1C(O)=O
BDBM50285113 C[C@]1(CCl)[C@@H](N2[C@@H]([C@@H](Br)C2=O)S1(=O)=O)C(O)=O
BDBM50285114 C[C@@]1(CCl)S[C@@H]2[C@@H](Cl)C(=O)N2[C@H]1C(O)=O
BDBM50285115 C[C@]1(CCl)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O
BDBM50285116 C[C@@]1(CCl)S[C@@H]2[C@@H](F)C(=O)N2[C@H]1C(O)=O
BDBM50285117 C[C@]1(CCl)[C@@H](N2[C@@H]([C@@H](Cl)C2=O)S1(=O)=O)C(O)=O
BDBM50285118 C[C@@]1(CSc2nc3ccccc3s2)S[C@@H]2[C@@H](Cl)C(=O)N2[C@H]1C(O)=O