BindingDB logo
myBDB logout

15 SMILES Strings for Beta-lactamase 2

Compound NameSMILES String
BDBM26116 OC(=O)c1cccc(n1)C(O)=O
BDBM50076672 CC1(C)[C@@H](N2[C@@H]([C@@H](CO)C2=O)S1(=O)=O)C(O)=O
BDBM50076678 CC1(C)[C@@H](N2[C@@H]([C@H](CO)C2=O)S1(=O)=O)C(O)=O
BDBM50140665 CC1(C)S[C@@H]2[C@H](S)C(=O)N2[C@H]1C(O)=O
BDBM50140666 CC1(C)[C@@H](N2[C@@H]([C@H](CS)C2=O)S1(=O)=O)C(O)=O
BDBM50140667 CC1(C)S[C@@H]2[C@@H](CS)C(=O)N2[C@H]1C(O)=O
BDBM50140668 CC1(C)[C@@H](N2[C@@H]([C@@H](CS)C2=O)S1(=O)=O)C(O)=O
BDBM50140669 CC1(C)[C@@H](N2[C@@H]([C@@H](S)C2=O)S1(=O)=O)C(O)=O
BDBM50140670 CC1(C)S[C@@H]2[C@@H](S)C(=O)N2[C@H]1C(O)=O
BDBM50140671 CC1(C)S[C@@H]2[C@@H](CO)C(=O)N2[C@H]1C(O)=O
BDBM50140672 CC1(C)S[C@@H]2[C@H](CO)C(=O)N2[C@H]1C(O)=O
BDBM50140673 CC1(C)S[C@@H]2[C@H](CS)C(=O)N2[C@H]1C(O)=O
BDBM50157692 C[C@]1(Cn2ccnn2)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(=O)O[Na] |r|
BDBM50174264 OC(=O)[C@@H](S)c1ccccc1 |r|
BDBM50174303 OC(=O)[C@H](S)c1ccccc1 |r|