BindingDB logo
myBDB logout

2 SMILES Strings for Beta-lactamase OXA-10

Compound NameSMILES String
BDBM50293712 NC(CC(=O)OCc1ccccc1)(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1
BDBM50293713 O=C(COc1ccccc1)NC(CC(=O)OCc1ccccc1)(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1