BindingDB logo
myBDB logout

1 SMILES String for Beta-lactamase OXA-2

Compound NameSMILES String
BDBM50076680 C[C@]1(\C=C\C#N)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C([O-])=O