BindingDB logo
myBDB logout

1 SMILES String for Beta-lactamase SHV-11

Compound NameSMILES String
BDBM50021954 CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |r|