BindingDB logo
myBDB logout

10 SMILES Strings for Beta-lactamase SHV-5

Compound NameSMILES String
BDBM50315411 OB(O)CNS(=O)(=O)c1cc2c(Cl)ccc(Cl)c2s1
BDBM50347180 CO\N=C(/C(=O)NCP(O)(=O)Oc1ccc(C#N)c(F)c1)c1cnc(N)s1
BDBM50347181 CO\N=C(/C(=O)NCP(O)(=O)Oc1ccc(C#N)c(F)c1)c1cnc(NC(=O)C(Cl)(Cl)Cl)s1
BDBM50347182 CON=C(C(=O)NCP(O)(=O)Oc1ccc(C#N)c(F)c1)c1cccs1 |w:2.1|
BDBM50347183 CO\N=C(/C(=O)NCP(O)(=O)Oc1ccc(C#N)c(F)c1)c1cccs1
BDBM50347184 CO\N=C(\C(=O)NCP(O)(=O)Oc1ccc(C#N)c(F)c1)c1cccs1
BDBM50347185 OP(=O)(CNC(=O)C(N=O)c1cccs1)Oc1ccc(C#N)c(F)c1
BDBM50347186 CO\N=C(/C(=O)NCP(O)(O)=O)c1cccs1
BDBM50347187 CO\N=C(\C(=O)NCP(O)(O)=O)c1cccs1
BDBM50347188 [O-]P(=O)(CNC(=O)C(=N/OCCC[n+]1ccccc1)\c1cccs1)Oc1ccc(C#N)c(F)c1