BindingDB logo
myBDB logout

1 SMILES String for Beta-lactamase SHV-55

Compound NameSMILES String
BDBM50021959 OC\C=C1/O[C@@H]2CC(=O)N2[C@H]1C(O)=O |r|