BindingDB logo
myBDB logout

2 SMILES Strings for Beta-lactamase TEM-125

Compound NameSMILES String
BDBM50021959 OC\C=C1/O[C@@H]2CC(=O)N2[C@H]1C(O)=O |r|
BDBM50053173 C[C@]1(Cn2ccnn2)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |r|