BindingDB logo
myBDB logout

2 SMILES Strings for Beta-lactoglobulin

Compound NameSMILES String
BDBM50092056 C\C(=C/CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C |c:12|
BDBM50378566 CC1=C(\C=C\c2ccc(\C=C\C(O)=O)cc2)C(C)(C)CCC1 |c:1|