BindingDB logo
myBDB logout

10 SMILES Strings for Beta-secretase 2 (BACE2)

Compound NameSMILES String
BDBM165907 C[C@]1(CCSCC(N)=N1)c1cc(NC(=O)c2ccc(Cl)cn2)ccc1F |r,c:7|
BDBM165908 C[C@]1(CCSCC(N)=N1)c1cc(NC(=O)c2ccc(F)cn2)ccc1F |r,c:7|
BDBM165909 C[C@]1(CCS(=O)(=O)CC(N)=N1)c1cc(NC(=O)c2ccc(Cl)cn2)ccc1F |r,c:9|
BDBM165910 C[C@]1(CCS(=O)(=O)CC(N)=N1)c1cc(NC(=O)c2ccc(F)cn2)ccc1F |r,c:9|
BDBM165911 CC1SCC[C@](C)(N=C1N)c1cc(NC(=O)c2ccc(F)cn2)ccc1F |r,c:7|
BDBM165912 CC1SCC[C@](C)(N=C1N)c1cc(NC(=O)c2ccc(Cl)cn2)ccc1F |r,c:7|
BDBM165913 CC1C(N)=N[C@@](C)(CCS1(=O)=O)c1cc(NC(=O)c2ccc(F)cn2)ccc1F |r,c:3|
BDBM165914 CC1C(N)=N[C@@](C)(CCS1(=O)=O)c1cc(NC(=O)c2ccc(Cl)cn2)ccc1F |r,c:3|
BDBM165915 CC1C(N)=N[C@@](C)(CCS1(=O)=O)c1cc(NC(=O)c2[nH]ncc2Cl)ccc1F |r,c:3|
BDBM165916 CC1(C)C(N)=N[C@@](C)(CCS1(=O)=O)c1cc(NC(=O)c2ccc(F)cn2)ccc1F |r,c:4|