BindingDB logo
myBDB logout

3 SMILES Strings for Beta-xylosidase

Compound NameSMILES String
BDBM50096896 N\C(Cc1ccccc1)=[NH+]/C1OC(CO)C(O)C(O)C1O
BDBM50182798 O[C@H]1CNC[C@@H](O)[C@@H]1O |r|
BDBM50182802 CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)C1