BindingDB logo
myBDB logout

12 SMILES Strings for BiP isoform A

Compound NameSMILES String
BDBM4375 OC(=O)\C=C\c1ccc(O)c(O)c1
BDBM50332781 CC(=O)N(C1CCCCC1)c1nc(Cc2ccc(Cl)cc2)no1
BDBM50332782 COc1ccc(cc1)C(=N)NO
BDBM50332783 Cc1ccc(cc1)C(=N)NO
BDBM50332784 CC(C)Nc1nc(Cc2ccc(Cl)cc2)no1
BDBM50332785 CC(C)Nc1nc(no1)C1CCCCC1
BDBM50332786 Cc1ccc(cc1)-c1noc(NC2CCCCC2)n1
BDBM50332787 Clc1ccc(Cc2noc(NC3CCCCC3)n2)cc1
BDBM50332788 [O-][N+](=O)c1ccc(Cc2noc(NC3CCCCC3)n2)cc1
BDBM50332790 CC(=O)N(C1CCCCC1)c1nc(no1)-c1ccc(cc1)[N+]([O-])=O
BDBM50332791 CC(C)N(C(C)=O)c1nc(no1)-c1cccc(c1)[N+]([O-])=O
BDBM50332789 CN(C)CCCNc1nc(no1)-c1ccc(C)cc1