BindingDB logo
myBDB logout

7 SMILES Strings for Bifunctional dihydrofolate reductase-thymidylate synthase

Compound NameSMILES String
BDBM18268 COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC
BDBM50320789 CCCN(Cc1ccc2nc(N)nc(N)c2c1)c1ccc(OC)c(OCCCCC(=O)OC)c1
BDBM50320790 COc1ccc(NCc2ccc3nc(N)nc(N)c3c2)cc1OCCCC(O)=O
BDBM50320791 COc1ccc(NCc2ccc3nc(N)nc(N)c3c2)cc1OC
BDBM50320792 CCOC(=O)CCCOc1cc(NCc2ccc3nc(N)nc(N)c3c2)ccc1OC
BDBM50320793 COC(=O)CCCCOc1cc(NCc2ccc3nc(N)nc(N)c3c2)ccc1OC
BDBM50320794 COC(=O)c1ccc(COc2cc(NCc3ccc4nc(N)nc(N)c4c3)ccc2OC)cc1