BindingDB logo
myBDB logout

37 SMILES Strings for Bifunctional protein GlmU

Compound NameSMILES String
BDBM50365062 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N1C(C)Cc2ccccc12
BDBM50365063 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365064 COc1cc(OC)c(cc1NC(=S)NCC(O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365065 COc1cc(OC)c(cc1NC(=O)NCC(O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365066 COc1cc(OC)c(cc1NC(=O)COC(C)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365067 COc1cc(OC)c(cc1NC(=O)\C=C\C(O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365068 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365069 COc1cc(OC)c(cc1NC(=O)CSCC(O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365070 COc1cc(OC)c(cc1NC(=O)CSc1ccncc1)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365071 COc1cc(OC)c(cc1NC(=O)COc1ccc(cc1)C(C)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365072 COc1cc(OC)c(cc1NS(C)(=O)=O)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365073 COc1cc(OC)c(cc1NC(=O)c1ccccc1)S(=O)(=O)N1C(C)CCc2ccccc12
BDBM50365074 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1ccccc1
BDBM50365075 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N(C)c1ccccc1
BDBM50365076 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N(C(C)C)c1ccccc1
BDBM50365077 CCN(c1ccccc1C)S(=O)(=O)c1cc(NC(C)=O)c(OC)cc1OC
BDBM50365078 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N1CCCCC1C
BDBM50365079 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N1CCCC1C
BDBM50365080 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N1CCCCC1
BDBM50365081 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)N(C)C
BDBM50365096 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1-c1ccc(cc1)C(O)=O
BDBM50365097 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1N1CCC(CC1)C(O)=O
BDBM50365098 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1N1CCC(CC(O)=O)CC1
BDBM50365082 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1ccc(F)cc1
BDBM50365083 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1cccc(F)c1
BDBM50365084 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1ccccc1F
BDBM50365085 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1cccc(C)c1
BDBM50365086 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)Nc1ccc(C)cc1
BDBM50365087 COc1ccccc1CNS(=O)(=O)c1cc(NC(C)=O)c(OC)cc1OC
BDBM50365088 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)NCc1ccc2OCOc2c1
BDBM50365089 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)NCc1ccccc1Br
BDBM50365090 COC(=O)c1ccccc1CNS(=O)(=O)c1cc(NC(C)=O)c(OC)cc1OC
BDBM50365091 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)NCc1ccccc1N1CCCCC1
BDBM50365092 COc1cc(OC)c(cc1NC(C)=O)S(=O)(=O)NCc1ccccc1N1CCC(CO)CC1
BDBM50365093 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1N1CCCCC1
BDBM50365094 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1N1CCC(CO)CC1
BDBM50365095 COc1cc(OC)c(cc1NC(=O)CCC(O)=O)S(=O)(=O)NCc1ccccc1N1CCC(COC(=O)CCC(O)=O)CC1