BindingDB logo
myBDB logout

14 SMILES Strings for Biotin Carboxylase

Compound NameSMILES String
BDBM3436 Nc1ncc2cc(c(N)nc2n1)-c1c(Br)cccc1Br |(-5.18,.33,;-3.84,1.1,;-3.84,2.64,;-2.51,3.41,;-1.17,2.64,;.16,3.41,;1.49,2.64,;1.49,1.1,;2.83,.33,;.16,.33,;-1.17,1.1,;-2.51,.33,;2.83,3.41,;2.83,4.95,;1.49,5.72,;4.16,5.72,;5.49,4.95,;5.49,3.41,;4.16,2.64,;4.16,1.1,)|
BDBM32639 Nc1ncc(o1)C(=O)c1cccc(Br)c1
BDBM32640 CCCCN(Cc1ccccc1)C(=O)c1cnc(N)o1
BDBM32641 Nc1ncc(o1)C(=O)N(Cc1ccccc1)Cc1ccccc1
BDBM32642 Cc1ccccc1CN(Cc1ccc2OCCOc2c1)C(=O)c1cnc(N)o1
BDBM32643 CC1(C)CC(=O)c2c(N)ncnc2C1
BDBM32644 Cc1c(ccc2nc(N)nc(N)c12)-c1ccccc1
BDBM32645 Cc1nc(cs1)-c1ccnc(N)n1
BDBM32646 Nc1nc(cs1)-c1ccnc(N)n1
BDBM32647 Cc1nc(cn1Cc1c(Cl)cccc1Cl)-c1ccnc(N)n1
BDBM32648 Nc1nccc(n1)C(=O)c1ccccc1
BDBM32649 Cc1nc2nc(N)[nH]c2c(O)c1Cc1ccccc1
BDBM32650 Nc1nc(N)nc(OCCOc2ccccc2)n1
BDBM32651 [#6]\[#6](-[#6])=[#6]/[#6]-n1cnc(-[#7])c2ncnc12