BindingDB logo
myBDB logout

3 SMILES Strings for BirA Bifunctional Protein Mutant (V214A)

Compound NameSMILES String
BDBM12 [H][C@]12CS[C@@H](CCCCC(O)=O)[C@@]1([H])NC(=O)N2 |r|
BDBM19477 Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OCCCCC[C@@H]2SCC3NC(=O)NC23)[C@@H](O)[C@H]1O |r|
BDBM19478 Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OC(=O)CCCC[C@@H]2SCC3NC(=O)NC23)[C@@H](O)[C@H]1O |r|