BindingDB logo
myBDB logout

37 SMILES Strings for Bloom syndrome protein

Compound NameSMILES String
BDBM48721 Clc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1Cl
BDBM50225 Clc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1
BDBM50162 Fc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1
BDBM50440506 Clc1ccc(NC(=O)Nc2nnc(s2)-c2cccnc2)cc1Cl
BDBM50440507 Nc1ccc(cc1)-c1nnc(NC(=O)Nc2ccc(Cl)c(Cl)c2)s1
BDBM50440508 Clc1ccc(NC(=O)Nc2nc(cs2)-c2ccncc2)cc1Cl
BDBM50440509 Clc1ccc(NC(=O)Nc2cccc(n2)-c2ccncc2)cc1Cl
BDBM50440510 Clc1ccc(NC(=S)Nc2nnc(s2)-c2ccncc2)cc1Cl
BDBM50440511 NC(Nc1nnc(s1)-c1ccncc1)=Nc1ccc(Cl)c(Cl)c1 |w:14.16|
BDBM50440512 Clc1ccc(Nc2c(Nc3nnc(s3)-c3ccncc3)c(=O)c2=O)cc1Cl
BDBM50440514 Clc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C#N
BDBM50440515 Cc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1Cl
BDBM50440516 FC(F)(F)c1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1Cl
BDBM50440517 [O-][N+](=O)c1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1Cl
BDBM50440518 Nc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1Cl
BDBM50440519 Clc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1C#N
BDBM50440520 O=C(Nc1nnc(s1)-c1ccncc1)Nc1ccc(cc1)C#N
BDBM50440521 O=C(Nc1nnc(s1)-c1ccncc1)Nc1cccc(c1)C#N
BDBM50440522 Cc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1C#N
BDBM50440523 FC(F)(F)c1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1C#N
BDBM50440524 Brc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1Br
BDBM50440525 Brc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1
BDBM50440526 Cc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1Br
BDBM50440527 Brc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C#N
BDBM50440528 Brc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1C#N
BDBM50440529 Fc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1F
BDBM50440530 Cc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1F
BDBM50440531 Fc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C(F)(F)F
BDBM50440533 Fc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C#N
BDBM50440534 Nc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C(F)(F)F
BDBM50440535 FC(F)(F)c1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1-n1cncn1
BDBM50440536 Fc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1-n1cncn1
BDBM50440537 Cc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1-c1cn[nH]c1
BDBM50440538 O=C(Nc1nnc(s1)-c1ccncc1)Nc1ccc(-c2cn[nH]c2)c(c1)C#N
BDBM50440539 FC(F)(F)c1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1-c1cn[nH]c1
BDBM50440540 Fc1cc(NC(=O)Nc2nnc(s2)-c2ccncc2)ccc1-n1ccnc1
BDBM50440541 O=C(Nc1nnc(s1)-c1ccncc1)Nc1ccc(-c2ccc[nH]2)c(c1)C#N