BindingDB logo
myBDB logout

42 SMILES Strings for Bombesin

Compound NameSMILES String
BDBM29525 Cn1cc(C(=O)OCC2CCN(CCNS(C)(=O)=O)CC2)c2ccccc12
BDBM50010685 Oc1cc2CC[C@H]3NCc4ccccc4[C@H]3c2cc1O
BDBM50094703 Nc1ncnc2nc(cc(-c3cccc(Br)c3)c12)-c1ccc(nc1)N1CCOCC1
BDBM50314969 CCC(C)(C)Cc1cnc(CCc2ccc(cc2)-c2ccccn2)[nH]1
BDBM50317443 CC(=O)n1nc(N)c2c3CCN(Cc4ccccc4)Cc3c(nc12)N1CCCCC1
BDBM50317444 Cn1nc(N)c2c3CCN(Cc4ccccc4)Cc3c(nc12)N1CCCCC1
BDBM50317445 CC(C)(C)CNc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317446 CCNc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317447 CCC(C)(C)C(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317448 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317449 Nc1n[nH]c2nc(N3CCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317450 Nc1n[nH]c2nc(N3CCCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317451 O=C(Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12)C1CCCC1
BDBM50317452 CC(C)(C)CC(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317453 CC(C)(C)C(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317454 CC(C)C(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317455 CCC(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317456 CC(=O)Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317457 Nc1n[nH]c2nc(N3CCCCC3)c3CN(CCc3c12)C(=O)c1ccc(F)cc1
BDBM50317458 Nc1n[nH]c2nc(N3CCCCC3)c3CN(CCc4ccccc4)CCc3c12
BDBM50317459 CC(C)(C)CN1CCc2c(C1)c(nc1[nH]nc(N)c21)N1CCCCC1
BDBM50317460 CC(C)CN1CCc2c(C1)c(nc1[nH]nc(N)c21)N1CCCCC1
BDBM50317461 Nc1n[nH]c2nc(N3CCCCC3)c3CN(CC4CCCCC4)CCc3c12
BDBM50317462 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccc5OCOc5c4)CCc3c12
BDBM50317463 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4cccc(c4)C(F)(F)F)CCc3c12
BDBM50317464 COc1ccc(CN2CCc3c(C2)c(nc2[nH]nc(N)c32)N2CCCCC2)cc1
BDBM50317466 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccc4Cl)CCc3c12
BDBM50317467 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccccn4)CCc3c12
BDBM50317469 Nc1n[nH]c2nc(Nc3ccccc3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317470 Nc1n[nH]c2nc(NC3CCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317471 CC(C)Nc1nc2[nH]nc(N)c2c2CCN(Cc3ccccc3)Cc12
BDBM50317472 CN(C)c1nc2[nH]nc(N)c2c2CCN(Cc3ccccc3)Cc12
BDBM50317473 CN1CCN(CC1)c1nc2[nH]nc(N)c2c2CCN(Cc3ccccc3)Cc12
BDBM50317474 Nc1n[nH]c2nc(N3CCNCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317475 Nc1n[nH]c2nc(N3CCOCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317476 Nc1n[nH]c2nc(N3CCC(F)CC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50317477 CC1CCN(CC1)c1nc2[nH]nc(N)c2c2CCN(Cc3ccccc3)Cc12
BDBM50317478 Nc1n[nH]c2nc(N3CCCCCCC3)c3CN(Cc4ccccc4)CCc3c12
BDBM50313710 CCCCc1cnc([nH]1)C(CCCO)Cc1ccc(cc1)-c1ccccc1C(O)=O
BDBM50336889 O[C@@](Cc1ncc(CC2(CC2)C(F)(F)F)[nH]1)(c1ccc(cc1)-n1cccn1)C(F)(F)F |r|
BDBM50378777 Nc1n[nH]c2nc(N3CCCCC3)c3CNCCc3c12
BDBM50415868 Nc1n[nH]c2nc(N3CCCCC3)c3CN(Cc4ccc(F)cc4)CCc3c12