BindingDB logo
myBDB logout

2 SMILES Strings for Botulinum neurotoxin type B

Compound NameSMILES String
BDBM50360392 COc1ccc(\C=C(/C#N)c2nc3ccccc3[nH]2)cc1I
BDBM50360393 N#C\C(=C/c1ccc(s1)-c1cccs1)c1nc2ccccc2[nH]1