BindingDB logo
myBDB logout

6 SMILES Strings for Botulinum neurotoxin type E

Compound NameSMILES String
BDBM50322673 OC(=O)c1cc(Cl)ccc1-c1ccc(Cl)cc1C(=O)Nc1ccc-2c(Cc3ccccc-23)c1
BDBM50189880 OC(=O)c1cc(ccc1-c1ccc(cc1C(=O)Nc1ccc-2c(Cc3ccccc-23)c1)[N+]([O-])=O)[N+]([O-])=O
BDBM50189882 Clc1cc2Cc3cc(ccc3-c2c(Cl)c1)-n1c(=O)c2cc(Cl)ccc2c2ccc(Cl)cc2c1=O
BDBM50189883 OC(=O)c1ccccc1C(=O)c1ccc-2c(Cc3ccccc-23)c1
BDBM50189879 Oc1cc2cc3ccccc3cc2cc1C(=O)Nc1ccccc1
BDBM50189881 OC(=O)c1cc(Cl)ccc1-c1ccc(Cl)cc1C(=O)Nc1ccc-2c(Cc3cc(Cl)cc(Cl)c-23)c1