BindingDB logo
myBDB logout

1 SMILES String for Bovine viral diarrhoea virus polyprotein

Compound NameSMILES String
BDBM50181687 Clc1ccc(C=C2SC(=S)N(NS(=O)(=O)c3ccccc3)C2=O)cc1 |w:5.4|