BindingDB logo
myBDB logout

3 SMILES Strings for Integrin alpha5beta8

Compound NameSMILES String
BDBM297773 OC(=O)CC(N1CCN(CCCCNc2nc3ccccc3[nH]2)C1=O)c1cccc(c1)C(F)(F)F
BDBM297774 OC(=O)CC(N1CCN(CCCCNC2=NCc3ccccc3C2)C1=O)c1cccc(c1)C(F)(F)F |t:14|
BDBM297775 OC(=O)CC(N1CCN(CCCCNc2ccccn2)C1=O)c1cccc(c1)C(F)(F)F