BindingDB logo
myBDB logout

1 SMILES String for Integrin beta-1

Compound NameSMILES String
BDBM50137079 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCC(N)=O)NC(=O)[C@H](N)CSSC[C@@H](NC(=O)[C@H]2CCCN2C(=O)[C@H](CO)NC(=O)[C@@H](CC(O)=O)NC1=O)C(O)=O