BindingDB logo
myBDB logout

2 SMILES Strings for Integrin beta-7

Compound NameSMILES String
BDBM50137078 [H][C@]12O[C@]3(CCCC[C@@]3(OC)OC1[C@H](COCC(C)C)O[C@@H](OCC(O)=O)[C@@H]2OCc1ccccc1)OC
BDBM50070619 CC(C)C[C@H](NC(=O)c1cc2ccccc2cn1)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(N)=O