BindingDB logo
myBDB logout

2 SMILES Strings for Interferon gamma receptor 1

Compound NameSMILES String
BDBM277676 COc1cc(Nc2nccc(Oc3ccc(NC(=O)Nc4cc(cc(NS(C)(=O)=O)c4OC)C(C)(C)C)c4ccccc34)n2)cc(OCCOCCOCC(O)=O)c1
BDBM277677 COc1cc(Nc2cc(Oc3ccc(NC(=O)Nc4cc(cc(NS(C)(=O)=O)c4OC)C(C)(C)C)c4ccccc34)ccn2)cc(OCCOCCOCC(O)=O)c1