BindingDB logo
myBDB logout

1 SMILES String for Interleukin

Compound NameSMILES String
BDBM50010685 Oc1cc2CC[C@H]3NCc4ccccc4[C@H]3c2cc1O