BindingDB logo
myBDB logout

1 SMILES String for Interleukin 1-Alpha

Compound NameSMILES String
BDBM50094703 Nc1ncnc2nc(cc(-c3cccc(Br)c3)c12)-c1ccc(nc1)N1CCOCC1