BindingDB logo
myBDB logout

1 SMILES String for Interleukin-1 receptor antagonist protein

Compound NameSMILES String
BDBM50077028 CCCC[C@H](N)C(=O)Nc1cc(ccc1N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |r|