BindingDB logo
myBDB logout

7 SMILES Strings for Interleukin-10 (IL-10)

Compound NameSMILES String
BDBM192712 COc1ccc(N(C(=O)Nc2c(C)cccc2C)c2cc(Nc3ccc(cc3)N3CCN(C)CC3)ncn2)c(OC)c1
BDBM192713 COc1ccc(N2C(=O)N(Cc3cnc(Nc4ccc(cc4)N4CCN(C)CC4)nc23)c2c(C)cccc2Cl)c(OC)c1
BDBM192715 COc1ccc(nc1)N1C(=O)N(Cc2cnc(Nc3ccc(cc3OC)N3CCN(C)CC3)nc12)c1c(C)cccc1Cl
BDBM192714 COc1ccc(nc1)N1C(=O)N(Cc2cnc(Nc3ccc(cc3)N3CCN(C)CC3)nc12)c1c(C)cccc1Cl
BDBM192716 COc1ccc(nc1)N1C(=O)N(Cc2cnc(Nc3ccc(cc3OC)C3CCN(C)CC3)nc12)c1c(C)cccc1Cl
BDBM192717 CCOc1cc(ccc1Nc1ncc2CN(C(=O)N(c3ccc(OC)cn3)c2n1)c1c(C)cccc1Cl)C1CCN(C)CC1
BDBM192718 COc1ccc(nc1)N1C(=O)N(Cc2cnc(Nc3ccc(cc3OC(C)C)C3CCN(C)CC3)nc12)c1c(C)cccc1C