BindingDB logo
myBDB logout

23 SMILES Strings for Interleukin-17F

Compound NameSMILES String
BDBM247010 O=S(=O)(N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1)c1ccccc1
BDBM247023 C(C1CC2CCC1N2)n1ccc2cc(ccc12)-c1cnn(c1)C1CCCCO1 |TLB:0:1:5.4:7|
BDBM247026 C(C1CCNCC1)N1CCCc2cc(ccc12)-c1cnn(c1)C1CCCCO1
BDBM247027 FC(F)(F)CS(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247028 CC1(C)CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1
BDBM247029 Clc1ccc(cc1)S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247030 O=S(=O)(N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1)c1cccnc1
BDBM247031 Fc1ccccc1S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247032 C[C@@H]1CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1 |r|
BDBM247033 C[C@H]1CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1 |r|
BDBM247034 CS(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM261498 OC(c1ccc(CBr)cc1)(C(F)(F)F)C(F)(F)F
BDBM261499 O=COCc1ccc2NCCCc2c1
BDBM261500 OC(c1ccc(CN2CCCc3cc(COC=O)ccc23)cc1)(C(F)(F)F)C(F)(F)F
BDBM261501 CN(C)C(=O)c1ccc2N(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)CCCc2c1
BDBM261502 Brc1ccc2NC(=O)CCc2c1
BDBM261503 OC(c1ccc(CN2C(=O)CCc3cc(COC=O)ccc23)cc1)(C(F)(F)F)C(F)(F)F
BDBM261504 CN(C)C(=O)c1ccc2N(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)C(=O)CCc2c1
BDBM261505 Brc1ccc(NC(=O)\C=C\c2ccccc2)cc1
BDBM261506 OC(c1ccc(Cn2c3ccc(COC=O)cc3ccc2=O)cc1)(C(F)(F)F)C(F)(F)F
BDBM261507 CN(C)C(=O)c1ccc2n(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)c(=O)ccc2c1
BDBM261508 Brc1ccc2NCCc2c1
BDBM261509 OCC(=O)c1ccc2N(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)CCc2c1