BindingDB logo
myBDB logout

39 SMILES Strings for Interleukin-2 receptor alpha chain

Compound NameSMILES String
BDBM50147973 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1ccc(Cl)cc1Cl |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-9.65,-6.56,;-6.99,-6.56,;-5.64,-5.79,;-4.31,-6.56,)|
BDBM50147974 COC(=O)[C@H](Cc1ccc(cc1)C#Cc1ccccc1)NC(=O)C[C@H]1CCCN(C1)C(N)=N
BDBM50147975 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1ccc(O)cc1Cl |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-9.65,-6.56,;-6.99,-6.56,;-5.64,-5.79,;-4.31,-6.56,)|
BDBM50147976 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1ccccc1 |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-6.99,-6.56,;-5.64,-5.79,)|
BDBM50147977 [#7]\[#6](-[#7])=[#7]/[#6@H](-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1)-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1nc(no1)-c1ccc(Cl)cc1Cl
BDBM50147978 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@H](\[#7]=[#6](/[#7])-[#7])-[#6](-[#6])-[#6]
BDBM50147979 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8]-[#6]-c2ccc(-[#6]-[#6](-[#8])=O)cc2)c(Cl)c1Cl
BDBM50147980 COC(=O)[C@H](Cc1ccc(cc1)C#Cc1ccccc1)NC(=O)CNC(=O)[C@@H]1CCCN1C(N)=N
BDBM50147982 [#6]-n1nc(cc1-[#6]-1-[#6]-[#6]-[#7](-[#6]-[#6]-1)-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@H](\[#7]=[#6](/[#7])-[#7])-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1)-c1cccc(Cl)c1Cl
BDBM50147983 Cc1c([nH]nc1-c1cccc(Cl)c1Cl)C1CCN(CC1)C(=O)CNC(=O)[C@H](N=C(N)N)C1CCCCC1 |wD:26.29,(-4.64,-2.92,;-4.33,-1.4,;-2.93,-.75,;-3.12,.77,;-4.64,1.07,;-5.38,-.28,;-6.91,-.45,;-7.83,.79,;-9.37,.6,;-9.98,-.82,;-9.05,-2.05,;-9.68,-3.46,;-7.53,-1.87,;-6.62,-3.11,;-1.59,-1.5,;-1.58,-3.06,;-.25,-3.8,;1.08,-3.02,;1.07,-1.48,;-.27,-.72,;2.43,-3.78,;2.43,-5.32,;3.74,-2.99,;5.09,-3.76,;6.42,-2.97,;6.4,-1.43,;7.75,-3.73,;9.08,-2.95,;10.43,-3.69,;10.44,-5.23,;11.76,-2.92,;7.78,-5.27,;6.45,-6.04,;6.45,-7.58,;7.79,-8.34,;9.12,-7.56,;9.11,-6.02,)|
BDBM50147984 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8]-[#6]-c2ccccc2)c(Cl)c1Cl
BDBM50147985 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@H](\[#7]=[#6](/[#7])-[#7])-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM50147987 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8]-[#6]-c2ccc(cc2)-[#6](-[#8])=O)c(Cl)c1Cl
BDBM50147988 COC(=O)[C@H](Cc1ccc(cc1)C#Cc1ccccc1)NC(=O)CNC(=O)CNC(N)=N
BDBM50147989 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1ccccc1Cl |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;8.78,-3.16,;9.49,-4.52,;11.03,-4.59,;11.85,-3.3,;11.15,-1.92,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-6.99,-6.56,;-5.64,-5.79,;-4.31,-6.56,)|
BDBM50147990 Cc1cccc(c1)-c1cc([nH]n1)C1CCN(CC1)C(=O)CNC(=O)[C@H](N=C(N)N)C1CCCCC1 |wD:24.27,(-6.99,-8.1,;-6.99,-6.56,;-8.32,-5.79,;-8.32,-4.25,;-6.99,-3.48,;-5.64,-4.25,;-5.64,-5.79,;-4.36,-3.39,;-2.91,-3.93,;-1.96,-2.71,;-2.82,-1.45,;-4.31,-1.87,;-.42,-2.78,;.29,-4.15,;1.82,-4.21,;2.64,-2.91,;1.92,-1.55,;.38,-1.48,;4.18,-2.97,;4.9,-4.34,;5,-1.68,;6.54,-1.73,;7.37,-.43,;6.65,.92,;8.91,-.5,;9.73,.81,;11.27,.74,;11.97,-.63,;12.09,2.04,;9.61,-1.87,;8.78,-3.16,;9.49,-4.52,;11.03,-4.59,;11.85,-3.3,;11.15,-1.92,)|
BDBM50147991 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@H](-[#6])\[#7]=[#6](/[#7])-[#7]
BDBM50147992 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1ccc(Cl)c(Cl)c1 |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-9.65,-6.56,;-6.99,-6.56,;-6.99,-8.1,;-5.64,-5.79,)|
BDBM50147993 [#7]\[#6](-[#7])=[#7]/[#6@H](-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1)-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cccc(c1)-c1ccc(Cl)cc1Cl
BDBM50147994 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1cccc(Cl)c1 |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;8.78,-3.16,;9.49,-4.52,;11.03,-4.59,;11.85,-3.3,;11.15,-1.92,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-6.99,-6.56,;-6.99,-8.1,;-5.64,-5.79,)|
BDBM50147995 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](-[#6])-[#6]
BDBM50147996 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](-[#6]-[#6]-[#6](-[#7])=O)\[#7]=[#6](/[#7])-[#7]
BDBM50147997 [#6]-n1nc(cc1-c1cccc(Cl)c1Cl)-[#6]-1-[#6]-[#6]-[#7](-[#6]-[#6]-1)-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@H](\[#7]=[#6](/[#7])-[#7])-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM50147998 Cc1ccccc1-c1cc([nH]n1)C1CCN(CC1)C(=O)CNC(=O)[C@H](N=C(N)N)C1CCCCC1 |wD:24.27,(-4.31,-6.56,;-5.64,-5.79,;-6.99,-6.56,;-8.32,-5.79,;-8.32,-4.25,;-6.99,-3.48,;-5.64,-4.25,;-4.36,-3.39,;-2.91,-3.93,;-1.96,-2.71,;-2.82,-1.45,;-4.31,-1.87,;-.42,-2.78,;.29,-4.15,;1.82,-4.21,;2.64,-2.91,;1.92,-1.55,;.38,-1.48,;4.18,-2.97,;4.9,-4.34,;5,-1.68,;6.54,-1.73,;7.37,-.43,;6.65,.92,;8.91,-.5,;9.73,.81,;11.27,.74,;11.97,-.63,;12.09,2.04,;9.61,-1.87,;8.78,-3.16,;9.49,-4.52,;11.03,-4.59,;11.85,-3.3,;11.15,-1.92,)|
BDBM50147999 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](\[#7]=[#6](/[#7])-[#7])C([#6])([#6])[#6]
BDBM50148000 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1cccc(Cl)c1Cl
BDBM50148001 [#6]-[#8]-c1ccc(-c2cc(-[#6]-3-[#6]-[#6]-[#7](-[#6]-[#6]-3)-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](-[#6]-[#6](-[#6])-[#6])\[#7]=[#6](/[#7])-[#7])n(-[#6])n2)c(Cl)c1Cl
BDBM50148002 COc1ccc(-c2cc([nH]n2)C2CCN(CC2)C(=O)CNC(=O)[C@H](N=C(N)N)C2CCCCC2)c(Cl)c1 |wD:23.25,(-10.97,-5.79,;-9.65,-6.56,;-8.32,-5.79,;-8.32,-4.25,;-6.99,-3.48,;-5.64,-4.25,;-4.36,-3.39,;-2.91,-3.93,;-1.96,-2.71,;-2.82,-1.45,;-4.31,-1.87,;-.42,-2.78,;.29,-4.15,;1.82,-4.21,;2.64,-2.91,;1.92,-1.55,;.38,-1.48,;4.18,-2.97,;4.9,-4.34,;5,-1.68,;6.54,-1.73,;7.37,-.43,;6.65,.92,;8.91,-.5,;9.73,.81,;11.27,.74,;11.97,-.63,;12.09,2.04,;9.61,-1.87,;8.78,-3.16,;9.49,-4.52,;11.03,-4.59,;11.85,-3.3,;11.15,-1.92,;-5.64,-5.79,;-4.31,-6.56,;-6.99,-6.56,)|
BDBM50148003 [#6]-[#8]-[#6](=O)-c1ccc(-[#6]-[#8]-c2ccc(-c3cc(-[#6]-4-[#6]-[#6]-[#7](-[#6]-[#6]-4)-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](-[#6]-[#6](-[#6])-[#6])\[#7]=[#6](/[#7])-[#7])n(-[#6])n3)c(Cl)c2Cl)cc1
BDBM50148004 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8]-[#6]-c2cccc(c2)-[#6](-[#8])=O)c(Cl)c1Cl
BDBM50148005 COC(=O)[C@H](Cc1ccc(cc1)C#Cc1ccccc1)NC(=O)CNC(=O)CN(C)C(N)=N
BDBM50148006 [#6]-[#8]-[#6](=O)-[#6@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#7]-[#6](=O)-[#6]-[#7]-[#6](=O)-[#6@@H](-[#6]-[#6]-1-[#6]-[#6]-[#6]-[#6]-[#6]-1)\[#7]=[#6](/[#7])-[#7]
BDBM50148007 COCC(=O)N[C@@H](Cc1ccc(cc1)C#Cc1ccccc1)C(O)=O
BDBM50148008 NC(N)=N[C@H](C1CCCCC1)C(=O)NCC(=O)N1CCC(CC1)c1cc(n[nH]1)-c1cccc(Cl)c1Cl |wD:4.3,(11.97,-.63,;11.27,.74,;12.09,2.04,;9.73,.81,;8.91,-.5,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;7.37,-.43,;6.65,.92,;6.54,-1.73,;5,-1.68,;4.18,-2.97,;4.9,-4.34,;2.64,-2.91,;1.82,-4.21,;.29,-4.15,;-.42,-2.78,;.38,-1.48,;1.92,-1.55,;-1.96,-2.71,;-2.91,-3.93,;-4.36,-3.39,;-4.31,-1.87,;-2.82,-1.45,;-5.64,-4.25,;-6.99,-3.48,;-8.32,-4.25,;-8.32,-5.79,;-6.99,-6.56,;-6.99,-8.1,;-5.64,-5.79,;-4.31,-6.56,)|
BDBM50147970 [#6]-[#6](-[#6])-[#6]-[#6@@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8])c(Cl)c1Cl
BDBM50147971 COC(=O)[C@H](Cc1ccc(cc1)C#Cc1ccccc1)NC(=O)CNC(=O)[C@H]1CCCN1C(N)=N
BDBM50147972 Cc1cccc(-c2cc([nH]n2)C2CCN(CC2)C(=O)CNC(=O)[C@H](N=C(N)N)C2CCCCC2)c1C |wD:23.25,(-6.99,-8.1,;-6.99,-6.56,;-8.32,-5.79,;-8.32,-4.25,;-6.99,-3.48,;-5.64,-4.25,;-4.36,-3.39,;-2.91,-3.93,;-1.96,-2.71,;-2.82,-1.45,;-4.31,-1.87,;-.42,-2.78,;.29,-4.15,;1.82,-4.21,;2.64,-2.91,;1.92,-1.55,;.38,-1.48,;4.18,-2.97,;4.9,-4.34,;5,-1.68,;6.54,-1.73,;7.37,-.43,;6.65,.92,;8.91,-.5,;9.73,.81,;11.27,.74,;11.97,-.63,;12.09,2.04,;9.61,-1.87,;11.15,-1.92,;11.85,-3.3,;11.03,-4.59,;9.49,-4.52,;8.78,-3.16,;-5.64,-5.79,;-4.31,-6.56,)|
BDBM50229786 [#6]-[#6](-[#6])-[#6]-[#6](\[#7+]=[#6](\[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-1-[#6]-[#6]-[#6](-[#6]-[#6]-1)-c1cc(nn1-[#6])-c1ccc(-[#8]-[#6]-c2ccc(o2)-[#6](-[#8-])=O)c(Cl)c1Cl
BDBM50370390 [#6]-[#6]-[#6@@H](-[#6])-[#6@H](\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-[#6@@H](-[#6]-c1ccc(cc1)C#Cc1ccccc1)-[#6](=O)-[#8]-[#6]