BindingDB logo
myBDB logout

11 SMILES Strings for Interleukin-21

Compound NameSMILES String
BDBM247010 O=S(=O)(N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1)c1ccccc1
BDBM247023 C(C1CC2CCC1N2)n1ccc2cc(ccc12)-c1cnn(c1)C1CCCCO1 |TLB:0:1:5.4:7|
BDBM247026 C(C1CCNCC1)N1CCCc2cc(ccc12)-c1cnn(c1)C1CCCCO1
BDBM247027 FC(F)(F)CS(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247028 CC1(C)CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1
BDBM247029 Clc1ccc(cc1)S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247030 O=S(=O)(N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1)c1cccnc1
BDBM247031 Fc1ccccc1S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247032 C[C@@H]1CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1 |r|
BDBM247033 C[C@H]1CC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CN1S(=O)(=O)c1ccccc1 |r|
BDBM247034 CS(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1