BindingDB logo
myBDB logout

4 SMILES Strings for Interleukin-22

Compound NameSMILES String
BDBM247029 Clc1ccc(cc1)S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247030 O=S(=O)(N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1)c1cccnc1
BDBM247031 Fc1ccccc1S(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1
BDBM247034 CS(=O)(=O)N1CCC(Cn2ccc3cc(ccc23)-c2cn[nH]c2)CC1