BindingDB logo
myBDB logout

9 SMILES Strings for Interleukin-22 receptor subunit alpha-2

Compound NameSMILES String
BDBM261498 OC(c1ccc(CBr)cc1)(C(F)(F)F)C(F)(F)F
BDBM261499 O=COCc1ccc2NCCCc2c1
BDBM261500 OC(c1ccc(CN2CCCc3cc(COC=O)ccc23)cc1)(C(F)(F)F)C(F)(F)F
BDBM261504 CN(C)C(=O)c1ccc2N(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)C(=O)CCc2c1
BDBM261505 Brc1ccc(NC(=O)\C=C\c2ccccc2)cc1
BDBM261506 OC(c1ccc(Cn2c3ccc(COC=O)cc3ccc2=O)cc1)(C(F)(F)F)C(F)(F)F
BDBM261507 CN(C)C(=O)c1ccc2n(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)c(=O)ccc2c1
BDBM261508 Brc1ccc2NCCc2c1
BDBM261509 OCC(=O)c1ccc2N(Cc3ccc(cc3)C(O)(C(F)(F)F)C(F)(F)F)CCc2c1