BindingDB logo
myBDB logout

2 SMILES Strings for Interleukin-6 receptor alpha chain

Compound NameSMILES String
BDBM85330 Cc1nccn1CC1CCc2c(C1=O)c1ccccc1n2C
BDBM50231569 Cc1nccn1C[C@H]1CCc2c(C1=O)c1cccc3CCCn2c13